C24H18F4N6O6S3 — CID 122658060
2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-[[4-(trifluoromethoxy)phenyl]methylsulfonyl]methyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole (PubChem CID 122658060) has the molecular formula C24H18F4N6O6S3 and a molecular weight of 658.64 g/mol. Its IUPAC name is 2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-[[4-(trifluoromethoxy)phenyl]methylsulfonyl]methyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-[[4-(trifluoromethoxy)phenyl]methylsulfonyl]methyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 122658060 |
| Molecular Formula | C24H18F4N6O6S3 |
| Molecular Weight | 658.64 g/mol |
| Exact Mass | 658.04 |
| IUPAC Name | 2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-[[4-(trifluoromethoxy)phenyl]methylsulfonyl]methyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole |
| SMILES | O=S(O)NNCc1nnc(C(c2nc3ccc(-c4ccc(F)nc4)cc3s2)S(=O)(=O)Cc2ccc(OC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C24H18F4N6O6S3/c25-19-8-4-15(10-29-19)14-3-7-17-18(9-14)41-23(31-17)21(22-33-32-20(39-22)11-30-34-42(35)36)43(37,38)12-13-1-5-16(6-2-13)40-24(26,27)28/h1-10,21,30,34H,11-12H2,(H,35,36) |
| InChIKey | DKAORWJDFNRSJR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|