C24H24F3N3O7S3 — CID 90082232
[5-[[6-(4-butoxyphenyl)-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-1,3,4-oxadiazol-2-yl]methanesulfonic acid (PubChem CID 90082232) has the molecular formula C24H24F3N3O7S3 and a molecular weight of 619.67 g/mol. Its IUPAC name is [5-[[6-(4-butoxyphenyl)-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-1,3,4-oxadiazol-2-yl]methanesulfonic acid.
| Compound Name | [5-[[6-(4-butoxyphenyl)-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-1,3,4-oxadiazol-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 90082232 |
| Molecular Formula | C24H24F3N3O7S3 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.07 |
| IUPAC Name | [5-[[6-(4-butoxyphenyl)-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-1,3,4-oxadiazol-2-yl]methanesulfonic acid |
| SMILES | CCCCOc1ccc(-c2ccc3nc(C(c4nnc(CS(=O)(=O)O)o4)S(=O)(=O)CCC(F)(F)F)sc3c2)cc1 |
| InChI | InChI=1S/C24H24F3N3O7S3/c1-2-3-11-36-17-7-4-15(5-8-17)16-6-9-18-19(13-16)38-23(28-18)21(39(31,32)12-10-24(25,26)27)22-30-29-20(37-22)14-40(33,34)35/h4-9,13,21H,2-3,10-12,14H2,1H3,(H,33,34,35) |
| InChIKey | XRWDLJHYLXHCGS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 149.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|