C26H23F3N5O7S3- — CID 90056900
2-[[6-[3-(4-oxopiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole (PubChem CID 90056900) has the molecular formula C26H23F3N5O7S3- and a molecular weight of 670.69 g/mol. Its IUPAC name is 2-[[6-[3-(4-oxopiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[[6-[3-(4-oxopiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90056900 |
| Molecular Formula | C26H23F3N5O7S3- |
| Molecular Weight | 670.69 g/mol |
| Exact Mass | 670.07 |
| IUPAC Name | 2-[[6-[3-(4-oxopiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-(3,3,3-trifluoropropylsulfonyl)methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
| SMILES | O=C1CCN(C(=O)c2cccc(-c3ccc4nc(C(c5nnc(CNS(=O)[O-])o5)S(=O)(=O)CCC(F)(F)F)sc4c3)c2)CC1 |
| InChI | InChI=1S/C26H24F3N5O7S3/c27-26(28,29)8-11-44(39,40)22(23-33-32-21(41-23)14-30-43(37)38)24-31-19-5-4-16(13-20(19)42-24)15-2-1-3-17(12-15)25(36)34-9-6-18(35)7-10-34/h1-5,12-13,22,30H,6-11,14H2,(H,37,38)/p-1 |
| InChIKey | DPZNRZJGDCJEOV-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 175.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|