C24H26N6O7S3 — CID 122658084
2-[[6-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole (PubChem CID 122658084) has the molecular formula C24H26N6O7S3 and a molecular weight of 606.71 g/mol. Its IUPAC name is 2-[[6-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[[6-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 122658084 |
| Molecular Formula | C24H26N6O7S3 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | 2-[[6-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinohydrazinyl)methyl]-1,3,4-oxadiazole |
| SMILES | CS(=O)(=O)C(c1nnc(CNNS(=O)O)o1)c1nc2ccc(-c3cccc(C(=O)N4CCC(O)CC4)c3)cc2s1 |
| InChI | InChI=1S/C24H26N6O7S3/c1-40(35,36)21(22-28-27-20(37-22)13-25-29-39(33)34)23-26-18-6-5-15(12-19(18)38-23)14-3-2-4-16(11-14)24(32)30-9-7-17(31)8-10-30/h2-6,11-12,17,21,25,29,31H,7-10,13H2,1H3,(H,33,34) |
| InChIKey | RVNGMDIAXWHEAY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 187.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|