C28H32N4O7S2 — CID 123876216
tert-butyl 3-imino-3-[2-methylsulfonyl-2-[6-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]ethanimidoyl]oxypropanoate (PubChem CID 123876216) has the molecular formula C28H32N4O7S2 and a molecular weight of 600.72 g/mol. Its IUPAC name is tert-butyl 3-imino-3-[2-methylsulfonyl-2-[6-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]ethanimidoyl]oxypropanoate.
| Compound Name | tert-butyl 3-imino-3-[2-methylsulfonyl-2-[6-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]ethanimidoyl]oxypropanoate |
|---|---|
| PubChem CID | 123876216 |
| Molecular Formula | C28H32N4O7S2 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | tert-butyl 3-imino-3-[2-methylsulfonyl-2-[6-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]ethanimidoyl]oxypropanoate |
| SMILES | [H]/N=C(\O/C(CC(=O)OC(C)(C)C)=N/[H])C(c1nc2ccc(-c3ccc(C(=O)N4CCOCC4)cc3)cc2s1)S(C)(=O)=O |
| InChI | InChI=1S/C28H32N4O7S2/c1-28(2,3)39-23(33)16-22(29)38-25(30)24(41(4,35)36)26-31-20-10-9-19(15-21(20)40-26)17-5-7-18(8-6-17)27(34)32-11-13-37-14-12-32/h5-10,15,24,29-30H,11-14,16H2,1-4H3/b29-22+,30-25- |
| InChIKey | MSBZVUNCTURCQZ-QDGSUQERSA-N |
| XLogP | 4.22 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|