C13H19ClN4 — CID 122668562
5-[(2-chloropyrimidin-5-yl)methyl]-2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 122668562) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is 5-[(2-chloropyrimidin-5-yl)methyl]-2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[(2-chloropyrimidin-5-yl)methyl]-2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 122668562 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 5-[(2-chloropyrimidin-5-yl)methyl]-2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CCN1CC2CN(Cc3cnc(Cl)nc3)CC2C1 |
| InChI | InChI=1S/C13H19ClN4/c1-2-17-6-11-8-18(9-12(11)7-17)5-10-3-15-13(14)16-4-10/h3-4,11-12H,2,5-9H2,1H3 |
| InChIKey | FWHQOXGEYCWXSM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |