C27H24F9NO5S2 — CID 122669282
[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1,1-dioxothian-4-yl)methanone (PubChem CID 122669282) has the molecular formula C27H24F9NO5S2 and a molecular weight of 677.61 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1,1-dioxothian-4-yl)methanone.
| Compound Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 122669282 |
| Molecular Formula | C27H24F9NO5S2 |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 677.10 |
| IUPAC Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1,1-dioxothian-4-yl)methanone |
| SMILES | O=C(N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12)C1(F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C27H24F9NO5S2/c28-18-3-5-19(6-4-18)44(41,42)24-9-12-37(22(38)23(29)10-13-43(39,40)14-11-23)21(24)8-1-16-15-17(2-7-20(16)24)25(30,26(31,32)33)27(34,35)36/h2-7,15,21H,1,8-14H2/t21-,24-/m1/s1 |
| InChIKey | LLGWTSRFQCMJHP-ZJSXRUAMSA-N |
| XLogP | 5.25 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |