C25H23F8NO5S2 — CID 118217911
(1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118217911) has the molecular formula C25H23F8NO5S2 and a molecular weight of 633.58 g/mol. Its IUPAC name is (1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | (1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118217911 |
| Molecular Formula | C25H23F8NO5S2 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 633.09 |
| IUPAC Name | (1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCS(=O)(=O)CC1)N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H23F8NO5S2/c26-19-5-7-20(8-6-19)41(38,39)22(11-12-34(15-22)21(35)16-9-13-40(36,37)14-10-16)17-1-3-18(4-2-17)23(27,24(28,29)30)25(31,32)33/h1-8,16H,9-15H2/t22-/m0/s1 |
| InChIKey | ZOHVYFFYFCNUAZ-QFIPXVFZSA-N |
| XLogP | 4.84 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |