C27H26F8N2O4S — CID 118217596
1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 118217596) has the molecular formula C27H26F8N2O4S and a molecular weight of 626.57 g/mol. Its IUPAC name is 1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118217596 |
| Molecular Formula | C27H26F8N2O4S |
| Molecular Weight | 626.57 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C27H26F8N2O4S/c1-17(38)36-13-10-18(11-14-36)23(39)37-15-12-24(16-37,42(40,41)22-8-6-21(28)7-9-22)19-2-4-20(5-3-19)25(29,26(30,31)32)27(33,34)35/h2-9,18H,10-16H2,1H3/t24-/m0/s1 |
| InChIKey | ZCVYLZVBYDUMQY-DEOSSOPVSA-N |
| XLogP | 5.28 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |