C27H27F7N2O5S — CID 118208112
1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 118208112) has the molecular formula C27H27F7N2O5S and a molecular weight of 624.58 g/mol. Its IUPAC name is 1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118208112 |
| Molecular Formula | C27H27F7N2O5S |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 1-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CC[C@](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C27H27F7N2O5S/c1-17(37)35-13-10-18(11-14-35)23(38)36-15-12-24(16-36,42(40,41)22-8-6-21(28)7-9-22)19-2-4-20(5-3-19)25(39,26(29,30)31)27(32,33)34/h2-9,18,39H,10-16H2,1H3/t24-/m0/s1 |
| InChIKey | KJQFBTHRWLTPCF-DEOSSOPVSA-N |
| XLogP | 4.30 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |