C22H21F7N2O4S — CID 118217576
N-ethyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 118217576) has the molecular formula C22H21F7N2O4S and a molecular weight of 542.47 g/mol. Its IUPAC name is N-ethyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-ethyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 118217576 |
| Molecular Formula | C22H21F7N2O4S |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | N-ethyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H21F7N2O4S/c1-2-30-18(32)31-12-11-19(13-31,36(34,35)17-9-7-16(23)8-10-17)14-3-5-15(6-4-14)20(33,21(24,25)26)22(27,28)29/h3-10,33H,2,11-13H2,1H3,(H,30,32) |
| InChIKey | MBZXEXLFJWPIQL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |