C25H24F7NO4S — CID 118217548
cyclopentyl-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118217548) has the molecular formula C25H24F7NO4S and a molecular weight of 567.52 g/mol. Its IUPAC name is cyclopentyl-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclopentyl-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118217548 |
| Molecular Formula | C25H24F7NO4S |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | cyclopentyl-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H24F7NO4S/c26-19-9-11-20(12-10-19)38(36,37)22(13-14-33(15-22)21(34)16-3-1-2-4-16)17-5-7-18(8-6-17)23(35,24(27,28)29)25(30,31)32/h5-12,16,35H,1-4,13-15H2 |
| InChIKey | AWOZLZVEQAYRHZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |