C28H28F7NO5S — CID 118208086
4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methylphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118208086) has the molecular formula C28H28F7NO5S and a molecular weight of 623.59 g/mol. Its IUPAC name is 4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methylphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methylphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118208086 |
| Molecular Formula | C28H28F7NO5S |
| Molecular Weight | 623.59 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | 4-[(3R)-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(4-methylphenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)[C@@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(C(=O)C3CCC(C(=O)O)CC3)C2)cc1 |
| InChI | InChI=1S/C28H28F7NO5S/c1-17-2-12-22(13-3-17)42(40,41)25(14-15-36(16-25)23(37)18-4-6-19(7-5-18)24(38)39)20-8-10-21(11-9-20)26(29,27(30,31)32)28(33,34)35/h2-3,8-13,18-19H,4-7,14-16H2,1H3,(H,38,39)/t18?,19?,25-/m0/s1 |
| InChIKey | PSNZDXCQJULFRM-BRVOVERQSA-N |
| XLogP | 6.08 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |