C28H27F8NO5S — CID 118217609
4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118217609) has the molecular formula C28H27F8NO5S and a molecular weight of 641.58 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217609 |
| Molecular Formula | C28H27F8NO5S |
| Molecular Weight | 641.58 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | 4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)[C@@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(C(=O)C3CCC(C(=O)O)CC3)C2)ccc1F |
| InChI | InChI=1S/C28H27F8NO5S/c1-16-14-21(10-11-22(16)29)43(41,42)25(12-13-37(15-25)23(38)17-2-4-18(5-3-17)24(39)40)19-6-8-20(9-7-19)26(30,27(31,32)33)28(34,35)36/h6-11,14,17-18H,2-5,12-13,15H2,1H3,(H,39,40)/t17?,18?,25-/m0/s1 |
| InChIKey | FOMZHKMHJLHIQZ-KRFIBBNCSA-N |
| XLogP | 6.22 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |