C20H17ClFN3O4 — CID 122669456
[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(2-fluorophenyl)methanone (PubChem CID 122669456) has the molecular formula C20H17ClFN3O4 and a molecular weight of 417.82 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 122669456 |
| Molecular Formula | C20H17ClFN3O4 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(2-fluorophenyl)methanone |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(=O)c1ccccc1F)O[C@H]2n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C20H17ClFN3O4/c1-20(2)28-15-14(13(26)10-5-3-4-6-12(10)22)27-19(16(15)29-20)25-8-7-11-17(21)23-9-24-18(11)25/h3-9,14-16,19H,1-2H3/t14-,15-,16-,19-/m1/s1 |
| InChIKey | ZJQIPVOIYUXKOH-YKTARERQSA-N |
| XLogP | 3.52 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |