C21H17ClN4O4 — CID 122669467
4-[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]benzonitrile (PubChem CID 122669467) has the molecular formula C21H17ClN4O4 and a molecular weight of 424.84 g/mol. Its IUPAC name is 4-[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]benzonitrile.
| Compound Name | 4-[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 122669467 |
| Molecular Formula | C21H17ClN4O4 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4-[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]benzonitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(=O)c1ccc(C#N)cc1)O[C@H]2n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C21H17ClN4O4/c1-21(2)29-16-15(14(27)12-5-3-11(9-23)4-6-12)28-20(17(16)30-21)26-8-7-13-18(22)24-10-25-19(13)26/h3-8,10,15-17,20H,1-2H3/t15-,16-,17-,20-/m1/s1 |
| InChIKey | SCCZRVUPYQHILV-WOCWXWTJSA-N |
| XLogP | 3.26 |
| TPSA | 99.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |