C4H2N2O2 — CID 122672156
[1,3]oxazolo[5,4-c][1,2]oxazole (PubChem CID 122672156) has the molecular formula C4H2N2O2 and a molecular weight of 110.07 g/mol. Its IUPAC name is [1,3]oxazolo[5,4-c][1,2]oxazole.
| Compound Name | [1,3]oxazolo[5,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 122672156 |
| Molecular Formula | C4H2N2O2 |
| Molecular Weight | 110.07 g/mol |
| Exact Mass | 110.01 |
| IUPAC Name | [1,3]oxazolo[5,4-c][1,2]oxazole |
| SMILES | c1nc2conc2o1 |
| InChI | InChI=1S/C4H2N2O2/c1-3-4(6-8-1)7-2-5-3/h1-2H |
| InChIKey | XVYOTYXROFCXBG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.07 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |