C5H10N4 — CID 122672176
1-N,2-N-dimethylimidazole-1,2-diamine (PubChem CID 122672176) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-N,2-N-dimethylimidazole-1,2-diamine.
| Compound Name | 1-N,2-N-dimethylimidazole-1,2-diamine |
|---|---|
| PubChem CID | 122672176 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 1-N,2-N-dimethylimidazole-1,2-diamine |
| SMILES | CNc1nccn1NC |
| InChI | InChI=1S/C5H10N4/c1-6-5-8-3-4-9(5)7-2/h3-4,7H,1-2H3,(H,6,8) |
| InChIKey | OXXAMZAEHKRLAL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |