About [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate
[2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate (PubChem CID 122672269) has the molecular formula C16H18ClF2NO4S
and a molecular weight of 393.84 g/mol. Its IUPAC name is [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate.
Molecular Properties
| Compound Name | [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate |
| PubChem CID | 122672269 |
| Molecular Formula | C16H18ClF2NO4S |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCC2(CC1)CCN(c1cc(F)c(F)cc1Cl)C2=O |
| InChI | InChI=1S/C16H18ClF2NO4S/c1-25(22,23)24-10-2-4-16(5-3-10)6-7-20(15(16)21)14-9-13(19)12(18)8-11(14)17/h8-10H,2-7H2,1H3 |
| InChIKey | WKFYASHKNBMALO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate?
The IUPAC name of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate (CID 122672269) is [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate.
What is the SMILES notation for [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate?
The canonical SMILES for [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate is CS(=O)(=O)OC1CCC2(CC1)CCN(c1cc(F)c(F)cc1Cl)C2=O.
What is the InChIKey of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate?
The InChIKey is WKFYASHKNBMALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClF2NO4S/c1-25(22,23)24-10-2-4-16(5-3-10)6-7-20(15(16)21)14-9-13(19)12(18)8-11(14)17/h8-10H,2-7H2,1H3.
What are the key properties of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate?
[2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate has a molecular weight of 393.84 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfonate is sourced from PubChem (CID 122672269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).