C15H17ClFNO2 — CID 122672326
2-(2-chloro-4-fluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one (PubChem CID 122672326) has the molecular formula C15H17ClFNO2 and a molecular weight of 297.76 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 122672326 |
| Molecular Formula | C15H17ClFNO2 |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2ccc(F)cc2Cl)CCC12CCC(O)CC2 |
| InChI | InChI=1S/C15H17ClFNO2/c16-12-9-10(17)1-2-13(12)18-8-7-15(14(18)20)5-3-11(19)4-6-15/h1-2,9,11,19H,3-8H2 |
| InChIKey | BYJIDMIUZOJZSQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |