C19H16N2OS — CID 122673577
5-(1,3-benzothiazol-2-yl)-1-benzyl-2,6-dihydropyridin-3-one (PubChem CID 122673577) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-benzyl-2,6-dihydropyridin-3-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-benzyl-2,6-dihydropyridin-3-one |
|---|---|
| PubChem CID | 122673577 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-benzyl-2,6-dihydropyridin-3-one |
| SMILES | O=C1C=C(c2nc3ccccc3s2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H16N2OS/c22-16-10-15(19-20-17-8-4-5-9-18(17)23-19)12-21(13-16)11-14-6-2-1-3-7-14/h1-10H,11-13H2 |
| InChIKey | DLDHUFARLCARAN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |