C11H18FNO2 — CID 122675589
1-[4-fluoro-4-(1-hydroxyethenyl)piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 122675589) has the molecular formula C11H18FNO2 and a molecular weight of 215.27 g/mol. Its IUPAC name is 1-[4-fluoro-4-(1-hydroxyethenyl)piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-fluoro-4-(1-hydroxyethenyl)piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 122675589 |
| Molecular Formula | C11H18FNO2 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-[4-fluoro-4-(1-hydroxyethenyl)piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | C=C(O)C1(F)CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C11H18FNO2/c1-8(2)10(15)13-6-4-11(12,5-7-13)9(3)14/h8,14H,3-7H2,1-2H3 |
| InChIKey | PGOSVVJYYQGUFN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|