C11H18F3NO2 — CID 155953063
1-[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 155953063) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 155953063 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | COC1(C(F)(F)F)CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C11H18F3NO2/c1-8(2)9(16)15-6-4-10(17-3,5-7-15)11(12,13)14/h8H,4-7H2,1-3H3 |
| InChIKey | UAKTZLHWPVZKJV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |