C10H15F3N2O3 — CID 177326086
ethanimidoyl 4-methoxy-4-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 177326086) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is ethanimidoyl 4-methoxy-4-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | ethanimidoyl 4-methoxy-4-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177326086 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | ethanimidoyl 4-methoxy-4-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | [H]/N=C(\C)OC(=O)N1CCC(OC)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H15F3N2O3/c1-7(14)18-8(16)15-5-3-9(17-2,4-6-15)10(11,12)13/h14H,3-6H2,1-2H3/b14-7+ |
| InChIKey | QCSXONXFDFYBQK-VGOFMYFVSA-N |
| XLogP | 2.16 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|