C13H24N4O3 — CID 123194670
tert-butyl 4-(C-ethanimidoyloxycarbonimidoyl)-1,4-diazepane-1-carboxylate (PubChem CID 123194670) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl 4-(C-ethanimidoyloxycarbonimidoyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(C-ethanimidoyloxycarbonimidoyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 123194670 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | tert-butyl 4-(C-ethanimidoyloxycarbonimidoyl)-1,4-diazepane-1-carboxylate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])N1CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H24N4O3/c1-10(14)19-11(15)16-6-5-7-17(9-8-16)12(18)20-13(2,3)4/h14-15H,5-9H2,1-4H3/b14-10+,15-11- |
| InChIKey | XKMREDLJQZKKPF-AIWUCEOPSA-N |
| XLogP | 1.88 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|