C29H25F4NO4 — CID 122676149
4-[9b-benzyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid (PubChem CID 122676149) has the molecular formula C29H25F4NO4 and a molecular weight of 527.51 g/mol. Its IUPAC name is 4-[9b-benzyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid.
| Compound Name | 4-[9b-benzyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 122676149 |
| Molecular Formula | C29H25F4NO4 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 4-[9b-benzyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid |
| SMILES | CC(F)(c1ccc2c(c1)OCC1N(C(=O)c3ccc(C(=O)O)cc3)CCC21Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C29H25F4NO4/c1-27(30,29(31,32)33)21-11-12-22-23(15-21)38-17-24-28(22,16-18-5-3-2-4-6-18)13-14-34(24)25(35)19-7-9-20(10-8-19)26(36)37/h2-12,15,24H,13-14,16-17H2,1H3,(H,36,37) |
| InChIKey | GPDKGGIMAIUVBR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |