C31H26F5NO3 — CID 148953357
6-[8b-[(4-fluorophenyl)methyl]-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carbonyl]-4H-chromen-3-one (PubChem CID 148953357) has the molecular formula C31H26F5NO3 and a molecular weight of 555.54 g/mol. Its IUPAC name is 6-[8b-[(4-fluorophenyl)methyl]-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carbonyl]-4H-chromen-3-one.
| Compound Name | 6-[8b-[(4-fluorophenyl)methyl]-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carbonyl]-4H-chromen-3-one |
|---|---|
| PubChem CID | 148953357 |
| Molecular Formula | C31H26F5NO3 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 6-[8b-[(4-fluorophenyl)methyl]-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carbonyl]-4H-chromen-3-one |
| SMILES | CC(F)(c1ccc2c(c1)CC1N(C(=O)c3ccc4c(c3)CC(=O)CO4)CCC21Cc1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C31H26F5NO3/c1-29(33,31(34,35)36)22-5-8-25-20(13-22)15-27-30(25,16-18-2-6-23(32)7-3-18)10-11-37(27)28(39)19-4-9-26-21(12-19)14-24(38)17-40-26/h2-9,12-13,27H,10-11,14-17H2,1H3 |
| InChIKey | PQJHUQPBJHPITM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |