C29H30F7NO — CID 122676403
[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone (PubChem CID 122676403) has the molecular formula C29H30F7NO and a molecular weight of 541.55 g/mol. Its IUPAC name is [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone.
| Compound Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 122676403 |
| Molecular Formula | C29H30F7NO |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone |
| SMILES | CC(F)(c1ccc2c(c1)CC[C@H]1N(C(=O)C3CCC(F)(F)CC3)CC[C@@]21Cc1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H30F7NO/c1-26(31,29(34,35)36)21-5-8-23-20(16-21)4-9-24-27(23,17-18-2-6-22(30)7-3-18)14-15-37(24)25(38)19-10-12-28(32,33)13-11-19/h2-3,5-8,16,19,24H,4,9-15,17H2,1H3/t24-,26?,27-/m1/s1 |
| InChIKey | MIEPMSJADKCTLU-FXQIWMCUSA-N |
| XLogP | 7.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |