C27H28F5NO3S — CID 122676360
[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 122676360) has the molecular formula C27H28F5NO3S and a molecular weight of 541.58 g/mol. Its IUPAC name is [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 122676360 |
| Molecular Formula | C27H28F5NO3S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | CC(F)(c1ccc2c(c1)CC[C@H]1N(C(=O)C3CCS(=O)(=O)C3)CC[C@@]21Cc1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H28F5NO3S/c1-25(29,27(30,31)32)20-5-8-22-18(14-20)4-9-23-26(22,15-17-2-6-21(28)7-3-17)11-12-33(23)24(34)19-10-13-37(35,36)16-19/h2-3,5-8,14,19,23H,4,9-13,15-16H2,1H3/t19?,23-,25?,26-/m1/s1 |
| InChIKey | WTNQHQUHPQQVRU-YSPNUWHFSA-N |
| XLogP | 5.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |