C31H35F5N2O3S — CID 122676373
N-[6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]spiro[3.3]heptan-2-yl]methanesulfonamide (PubChem CID 122676373) has the molecular formula C31H35F5N2O3S and a molecular weight of 610.69 g/mol. Its IUPAC name is N-[6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]spiro[3.3]heptan-2-yl]methanesulfonamide.
| Compound Name | N-[6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]spiro[3.3]heptan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 122676373 |
| Molecular Formula | C31H35F5N2O3S |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | N-[6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]spiro[3.3]heptan-2-yl]methanesulfonamide |
| SMILES | CC(F)(c1ccc2c(c1)CC[C@H]1N(C(=O)C3CC4(CC(NS(C)(=O)=O)C4)C3)CC[C@@]21Cc1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C31H35F5N2O3S/c1-28(33,31(34,35)36)22-6-9-25-20(13-22)5-10-26-30(25,14-19-3-7-23(32)8-4-19)11-12-38(26)27(39)21-15-29(16-21)17-24(18-29)37-42(2,40)41/h3-4,6-9,13,21,24,26,37H,5,10-12,14-18H2,1-2H3/t21?,24?,26-,28?,29?,30-/m1/s1 |
| InChIKey | KZDLLJZWFQAGKC-IMNIOYCJSA-N |
| XLogP | 5.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |