C30H31F6NO3 — CID 159926428
4-[9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid (PubChem CID 159926428) has the molecular formula C30H31F6NO3 and a molecular weight of 567.57 g/mol. Its IUPAC name is 4-[9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid.
| Compound Name | 4-[9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 159926428 |
| Molecular Formula | C30H31F6NO3 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 4-[9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid |
| SMILES | CC(F)(c1ccc2c(c1)CCC1N(C(=O)C3(F)CCC(C(=O)O)CC3)CCC21Cc1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H31F6NO3/c1-27(32,30(34,35)36)21-5-8-23-20(16-21)4-9-24-28(23,17-18-2-6-22(31)7-3-18)14-15-37(24)26(40)29(33)12-10-19(11-13-29)25(38)39/h2-3,5-8,16,19,24H,4,9-15,17H2,1H3,(H,38,39) |
| InChIKey | NZBKXPOHEGHTQB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |