C27H29F5NO5P — CID 122676704
[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(2-hydroxy-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)methanone (PubChem CID 122676704) has the molecular formula C27H29F5NO5P and a molecular weight of 573.50 g/mol. Its IUPAC name is [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(2-hydroxy-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)methanone.
| Compound Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(2-hydroxy-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)methanone |
|---|---|
| PubChem CID | 122676704 |
| Molecular Formula | C27H29F5NO5P |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(2-hydroxy-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)methanone |
| SMILES | CC1(C(=O)N2CC[C@@]3(Cc4ccc(F)cc4)c4ccc(C(C)(F)C(F)(F)F)cc4CC[C@@H]23)COP(=O)(O)OC1 |
| InChI | InChI=1S/C27H29F5NO5P/c1-24(15-37-39(35,36)38-16-24)23(34)33-12-11-26(14-17-3-7-20(28)8-4-17)21-9-6-19(25(2,29)27(30,31)32)13-18(21)5-10-22(26)33/h3-4,6-9,13,22H,5,10-12,14-16H2,1-2H3,(H,35,36)/t22-,25?,26-/m1/s1 |
| InChIKey | GRCBJLUSGLPRBI-ROJAKFQKSA-N |
| XLogP | 5.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|