C29H32ClF4NO3S — CID 122676171
[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-methyl-1,1-dioxothian-4-yl)methanone (PubChem CID 122676171) has the molecular formula C29H32ClF4NO3S and a molecular weight of 586.09 g/mol. Its IUPAC name is [9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-methyl-1,1-dioxothian-4-yl)methanone.
| Compound Name | [9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-methyl-1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 122676171 |
| Molecular Formula | C29H32ClF4NO3S |
| Molecular Weight | 586.09 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | [9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-methyl-1,1-dioxothian-4-yl)methanone |
| SMILES | CC1(C(=O)N2CCC3(Cc4ccc(Cl)cc4)c4ccc(C(C)(F)C(F)(F)F)cc4CCC23)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C29H32ClF4NO3S/c1-26(12-15-39(37,38)16-13-26)25(36)35-14-11-28(18-19-3-7-22(30)8-4-19)23-9-6-21(27(2,31)29(32,33)34)17-20(23)5-10-24(28)35/h3-4,6-9,17,24H,5,10-16,18H2,1-2H3 |
| InChIKey | VNDHZXVVLOEAJC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.09 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |