C30H30ClF4N3O2 — CID 122676767
3-[(2S)-2-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile (PubChem CID 122676767) has the molecular formula C30H30ClF4N3O2 and a molecular weight of 576.03 g/mol. Its IUPAC name is 3-[(2S)-2-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile.
| Compound Name | 3-[(2S)-2-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 122676767 |
| Molecular Formula | C30H30ClF4N3O2 |
| Molecular Weight | 576.03 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 3-[(2S)-2-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile |
| SMILES | CC(F)(c1ccc2c(c1)CCC1N(C(=O)[C@@H]3CCC(=O)N3CCC#N)CCC21Cc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H30ClF4N3O2/c1-28(32,30(33,34)35)21-6-9-23-20(17-21)5-11-25-29(23,18-19-3-7-22(31)8-4-19)13-16-38(25)27(40)24-10-12-26(39)37(24)15-2-14-36/h3-4,6-9,17,24-25H,2,5,10-13,15-16,18H2,1H3/t24-,25?,28?,29?/m0/s1 |
| InChIKey | QEKCRMVESMLOEM-KJWZKSEYSA-N |
| XLogP | 6.02 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.03 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |