C29H33F5N2O3S — CID 122676333
[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 122676333) has the molecular formula C29H33F5N2O3S and a molecular weight of 584.65 g/mol. Its IUPAC name is [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 122676333 |
| Molecular Formula | C29H33F5N2O3S |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CC(F)(c1ccc2c(c1)CC[C@H]1N(C(=O)C3CCN(S(C)(=O)=O)CC3)CC[C@@]21Cc1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H33F5N2O3S/c1-27(31,29(32,33)34)22-6-9-24-21(17-22)5-10-25-28(24,18-19-3-7-23(30)8-4-19)13-16-36(25)26(37)20-11-14-35(15-12-20)40(2,38)39/h3-4,6-9,17,20,25H,5,10-16,18H2,1-2H3/t25-,27?,28-/m1/s1 |
| InChIKey | YEVCXBBSKQCEGS-LWOXTOHASA-N |
| XLogP | 5.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |