C29H31F5N2O2 — CID 122676760
(6S)-6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpiperidin-2-one (PubChem CID 122676760) has the molecular formula C29H31F5N2O2 and a molecular weight of 534.57 g/mol. Its IUPAC name is (6S)-6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpiperidin-2-one.
| Compound Name | (6S)-6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 122676760 |
| Molecular Formula | C29H31F5N2O2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (6S)-6-[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpiperidin-2-one |
| SMILES | CN1C(=O)CCC[C@H]1C(=O)N1CC[C@@]2(Cc3ccc(F)cc3)c3ccc(C(C)(F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C29H31F5N2O2/c1-27(31,29(32,33)34)20-9-12-22-19(16-20)8-13-24-28(22,17-18-6-10-21(30)11-7-18)14-15-36(24)26(38)23-4-3-5-25(37)35(23)2/h6-7,9-12,16,23-24H,3-5,8,13-15,17H2,1-2H3/t23-,24+,27?,28+/m0/s1 |
| InChIKey | VDZFZDAHCNPDTL-FFBYWPQJSA-N |
| XLogP | 5.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |