C32H38F5NO2 — CID 122676206
[(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(2-hydroxypropan-2-yl)cyclohexyl]methanone (PubChem CID 122676206) has the molecular formula C32H38F5NO2 and a molecular weight of 563.65 g/mol. Its IUPAC name is [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(2-hydroxypropan-2-yl)cyclohexyl]methanone.
| Compound Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(2-hydroxypropan-2-yl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 122676206 |
| Molecular Formula | C32H38F5NO2 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | [(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(2-hydroxypropan-2-yl)cyclohexyl]methanone |
| SMILES | CC(C)(O)C1CCC(C(=O)N2CC[C@@]3(Cc4ccc(F)cc4)c4ccc(C(C)(F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C32H38F5NO2/c1-29(2,40)23-9-6-21(7-10-23)28(39)38-17-16-31(19-20-4-12-25(33)13-5-20)26-14-11-24(30(3,34)32(35,36)37)18-22(26)8-15-27(31)38/h4-5,11-14,18,21,23,27,40H,6-10,15-17,19H2,1-3H3/t21?,23?,27-,30?,31-/m1/s1 |
| InChIKey | NSKZRUSVXJOSIE-DVWIXIRRSA-N |
| XLogP | 7.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |