C32H34ClF4NO3 — CID 122676014
4-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 122676014) has the molecular formula C32H34ClF4NO3 and a molecular weight of 592.07 g/mol. Its IUPAC name is 4-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 122676014 |
| Molecular Formula | C32H34ClF4NO3 |
| Molecular Weight | 592.07 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 4-[9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | CC(F)(c1ccc2c(c1)CCC1N(C(=O)C34CCC(C(=O)O)(CC3)CC4)CCC21Cc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C32H34ClF4NO3/c1-28(34,32(35,36)37)22-5-8-24-21(18-22)4-9-25-31(24,19-20-2-6-23(33)7-3-20)16-17-38(25)26(39)29-10-13-30(14-11-29,15-12-29)27(40)41/h2-3,5-8,18,25H,4,9-17,19H2,1H3,(H,40,41) |
| InChIKey | VPSUXXJBOSGIHD-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.07 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |