C16H20O — CID 122676921
(4aS)-3,8a-dimethyl-2,5-dimethylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran (PubChem CID 122676921) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is (4aS)-3,8a-dimethyl-2,5-dimethylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran.
| Compound Name | (4aS)-3,8a-dimethyl-2,5-dimethylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran |
|---|---|
| PubChem CID | 122676921 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (4aS)-3,8a-dimethyl-2,5-dimethylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran |
| SMILES | C=C1CCCC2(C)C=c3oc(=C)c(C)c3C[C@@H]12 |
| InChI | InChI=1S/C16H20O/c1-10-6-5-7-16(4)9-15-13(8-14(10)16)11(2)12(3)17-15/h9,14H,1,3,5-8H2,2,4H3/t14-,16?/m0/s1 |
| InChIKey | TZXJYVJZSPDCOH-LBAUFKAWSA-N |
| XLogP | 2.70 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|