C40H56O — CID 163067577
4,4,7a-trimethyl-2-[6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-3a,5,6,7-tetrahydro-1-benzofuran (PubChem CID 163067577) has the molecular formula C40H56O and a molecular weight of 552.89 g/mol. Its IUPAC name is 4,4,7a-trimethyl-2-[6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-3a,5,6,7-tetrahydro-1-benzofuran.
| Compound Name | 4,4,7a-trimethyl-2-[6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-3a,5,6,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 163067577 |
| Molecular Formula | C40H56O |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.43 |
| IUPAC Name | 4,4,7a-trimethyl-2-[6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-3a,5,6,7-tetrahydro-1-benzofuran |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CC=CC=C(C)C=CC=C(C)C1=CC2C(C)(C)CCCC2(C)O1 |
| InChI | InChI=1S/C40H56O/c1-30(19-13-20-32(3)24-25-35-33(4)23-15-26-38(35,6)7)17-11-12-18-31(2)21-14-22-34(5)36-29-37-39(8,9)27-16-28-40(37,10)41-36/h11-14,17-22,24-25,29,37H,15-16,23,26-28H2,1-10H3 |
| InChIKey | FSLLIPKSVXRYJI-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|