C25H29N3O3 — CID 122677175
[3-[3-(2-methoxyethoxy)-4-methyl-1H-pyrazol-5-yl]-4-methylphenyl]-[3-(4-methylphenyl)azetidin-1-yl]methanone (PubChem CID 122677175) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [3-[3-(2-methoxyethoxy)-4-methyl-1H-pyrazol-5-yl]-4-methylphenyl]-[3-(4-methylphenyl)azetidin-1-yl]methanone.
| Compound Name | [3-[3-(2-methoxyethoxy)-4-methyl-1H-pyrazol-5-yl]-4-methylphenyl]-[3-(4-methylphenyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 122677175 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [3-[3-(2-methoxyethoxy)-4-methyl-1H-pyrazol-5-yl]-4-methylphenyl]-[3-(4-methylphenyl)azetidin-1-yl]methanone |
| SMILES | COCCOc1n[nH]c(-c2cc(C(=O)N3CC(c4ccc(C)cc4)C3)ccc2C)c1C |
| InChI | InChI=1S/C25H29N3O3/c1-16-5-8-19(9-6-16)21-14-28(15-21)25(29)20-10-7-17(2)22(13-20)23-18(3)24(27-26-23)31-12-11-30-4/h5-10,13,21H,11-12,14-15H2,1-4H3,(H,26,27) |
| InChIKey | OKZCRPFSLXBOAZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|