C21H24N4O — CID 122677769
[3-amino-4-(1-iminopent-1-en-2-ylamino)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 122677769) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is [3-amino-4-(1-iminopent-1-en-2-ylamino)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [3-amino-4-(1-iminopent-1-en-2-ylamino)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 122677769 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [3-amino-4-(1-iminopent-1-en-2-ylamino)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | CCCC(=C=N)Nc1ccc(C(=O)N2CCCc3ccccc32)cc1N |
| InChI | InChI=1S/C21H24N4O/c1-2-6-17(14-22)24-19-11-10-16(13-18(19)23)21(26)25-12-5-8-15-7-3-4-9-20(15)25/h3-4,7,9-11,13,22,24H,2,5-6,8,12,23H2,1H3 |
| InChIKey | UHXGBJKUULVJPN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|