C22H20F3N5O4 — CID 122677928
4-[(1S)-1-[amino-[1,3-dimethyl-5-[4-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]ethyl]-N-oxobenzamide (PubChem CID 122677928) has the molecular formula C22H20F3N5O4 and a molecular weight of 475.43 g/mol. Its IUPAC name is 4-[(1S)-1-[amino-[1,3-dimethyl-5-[4-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]ethyl]-N-oxobenzamide.
| Compound Name | 4-[(1S)-1-[amino-[1,3-dimethyl-5-[4-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]ethyl]-N-oxobenzamide |
|---|---|
| PubChem CID | 122677928 |
| Molecular Formula | C22H20F3N5O4 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 4-[(1S)-1-[amino-[1,3-dimethyl-5-[4-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]ethyl]-N-oxobenzamide |
| SMILES | Cc1nn(C)c(Oc2ccc(C(F)(F)F)cc2)c1C(=O)N(N)[C@@H](C)c1ccc(C(=O)N=O)cc1 |
| InChI | InChI=1S/C22H20F3N5O4/c1-12-18(20(32)30(26)13(2)14-4-6-15(7-5-14)19(31)28-33)21(29(3)27-12)34-17-10-8-16(9-11-17)22(23,24)25/h4-11,13H,26H2,1-3H3/t13-/m0/s1 |
| InChIKey | DWHQRVUVGITKOP-ZDUSSCGKSA-N |
| XLogP | 4.52 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|