C21H21N — CID 122678080
7-methyl-1-phenyl-3-[(E)-prop-1-enyl]-2-[(Z)-prop-1-enyl]indole (PubChem CID 122678080) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is 7-methyl-1-phenyl-3-[(E)-prop-1-enyl]-2-[(Z)-prop-1-enyl]indole.
| Compound Name | 7-methyl-1-phenyl-3-[(E)-prop-1-enyl]-2-[(Z)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 122678080 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 7-methyl-1-phenyl-3-[(E)-prop-1-enyl]-2-[(Z)-prop-1-enyl]indole |
| SMILES | C/C=C\c1c(/C=C/C)c2cccc(C)c2n1-c1ccccc1 |
| InChI | InChI=1S/C21H21N/c1-4-10-18-19-15-9-12-16(3)21(19)22(20(18)11-5-2)17-13-7-6-8-14-17/h4-15H,1-3H3/b10-4+,11-5- |
| InChIKey | DNKBGOJEODXTKP-CYQDLDFOSA-N |
| XLogP | 6.01 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |