C14H16NP — CID 154964307
[2,3-bis[(Z)-prop-1-enyl]indol-1-yl]phosphane (PubChem CID 154964307) has the molecular formula C14H16NP and a molecular weight of 229.26 g/mol. Its IUPAC name is [2,3-bis[(Z)-prop-1-enyl]indol-1-yl]phosphane.
| Compound Name | [2,3-bis[(Z)-prop-1-enyl]indol-1-yl]phosphane |
|---|---|
| PubChem CID | 154964307 |
| Molecular Formula | C14H16NP |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | [2,3-bis[(Z)-prop-1-enyl]indol-1-yl]phosphane |
| SMILES | C/C=C\c1c(/C=C\C)n(P)c2ccccc12 |
| InChI | InChI=1S/C14H16NP/c1-3-7-11-12-9-5-6-10-14(12)15(16)13(11)8-4-2/h3-10H,16H2,1-2H3/b7-3-,8-4- |
| InChIKey | JUZCUPRTRMKOJQ-VHOZIDCHSA-N |
| XLogP | 4.35 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|