About 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole
2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole (PubChem CID 137447929) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole.
Molecular Properties
| Compound Name | 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole |
| PubChem CID | 137447929 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole |
| SMILES | C=C(/C=C\C)n1c(C)c(/C=C\C)c2ccccc21 |
| InChI | InChI=1S/C17H19N/c1-5-9-13(3)18-14(4)15(10-6-2)16-11-7-8-12-17(16)18/h5-12H,3H2,1-2,4H3/b9-5-,10-6- |
| InChIKey | RRYQKZAJLRTCBD-OZDSWYPASA-N |
| XLogP | 5.03 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole?
The IUPAC name of 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole (CID 137447929) is 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole.
What is the SMILES notation for 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole?
The canonical SMILES for 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole is C=C(/C=C\C)n1c(C)c(/C=C\C)c2ccccc21.
What is the InChIKey of 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole?
The InChIKey is RRYQKZAJLRTCBD-OZDSWYPASA-N. The full InChI is InChI=1S/C17H19N/c1-5-9-13(3)18-14(4)15(10-6-2)16-11-7-8-12-17(16)18/h5-12H,3H2,1-2,4H3/b9-5-,10-6-.
What are the key properties of 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole?
2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole has a molecular weight of 237.35 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]-3-[(Z)-prop-1-enyl]indole is sourced from PubChem (CID 137447929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).