C22H21N — CID 171596836
9-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-3-yl]carbazole (PubChem CID 171596836) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is 9-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-3-yl]carbazole.
| Compound Name | 9-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-3-yl]carbazole |
|---|---|
| PubChem CID | 171596836 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 9-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-3-yl]carbazole |
| SMILES | C=C(/C=C\C)C(=C)/C(=C\C)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C22H21N/c1-5-11-16(3)17(4)20(6-2)23-21-14-9-7-12-18(21)19-13-8-10-15-22(19)23/h5-15H,3-4H2,1-2H3/b11-5-,20-6+ |
| InChIKey | RKWXMMGDOTXLFV-AGZPBZAGSA-N |
| XLogP | 6.34 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|