C37H42N2 — CID 143953082
3-[(Z)-but-1-enyl]-1-[(2E,4E)-5-[3-ethenyl-2,4,5-tris[(Z)-prop-1-enyl]pyrrol-1-yl]hepta-2,4,6-trien-3-yl]-2-[(Z)-prop-1-enyl]indole (PubChem CID 143953082) has the molecular formula C37H42N2 and a molecular weight of 514.76 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-1-[(2E,4E)-5-[3-ethenyl-2,4,5-tris[(Z)-prop-1-enyl]pyrrol-1-yl]hepta-2,4,6-trien-3-yl]-2-[(Z)-prop-1-enyl]indole.
| Compound Name | 3-[(Z)-but-1-enyl]-1-[(2E,4E)-5-[3-ethenyl-2,4,5-tris[(Z)-prop-1-enyl]pyrrol-1-yl]hepta-2,4,6-trien-3-yl]-2-[(Z)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 143953082 |
| Molecular Formula | C37H42N2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-1-[(2E,4E)-5-[3-ethenyl-2,4,5-tris[(Z)-prop-1-enyl]pyrrol-1-yl]hepta-2,4,6-trien-3-yl]-2-[(Z)-prop-1-enyl]indole |
| SMILES | C=C/C(=C\C(=C/C)n1c(/C=C\C)c(/C=C\CC)c2ccccc21)n1c(/C=C\C)c(C=C)c(/C=C\C)c1/C=C\C |
| InChI | InChI=1S/C37H42N2/c1-9-17-24-32-33-25-18-19-26-37(33)39(36(32)23-13-5)29(15-7)27-28(14-6)38-34(21-11-3)30(16-8)31(20-10-2)35(38)22-12-4/h10-27H,6,8-9H2,1-5,7H3/b20-10-,21-11-,22-12-,23-13-,24-17-,28-27+,29-15+ |
| InChIKey | XWUSMYXCAQZWTF-OGACMOQJSA-N |
| XLogP | 11.23 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|