C26H24BrN — CID 139554397
1-(4-bromophenyl)-2-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-3-[(Z)-prop-1-enyl]indole (PubChem CID 139554397) has the molecular formula C26H24BrN and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-3-[(Z)-prop-1-enyl]indole.
| Compound Name | 1-(4-bromophenyl)-2-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-3-[(Z)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 139554397 |
| Molecular Formula | C26H24BrN |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 1-(4-bromophenyl)-2-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-3-[(Z)-prop-1-enyl]indole |
| SMILES | C=C(/C=C\C=C/C)C(=C)c1c(/C=C\C)c2ccccc2n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H24BrN/c1-5-7-8-12-19(3)20(4)26-24(11-6-2)23-13-9-10-14-25(23)28(26)22-17-15-21(27)16-18-22/h5-18H,3-4H2,1-2H3/b7-5-,11-6-,12-8- |
| InChIKey | MTPSHNDCKVZCME-WQYCMUSESA-N |
| XLogP | 8.13 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|