C15H22BrN5O — CID 122679646
N-[(4-bromophenyl)methyl]-N,N',3,5-tetramethyl-4-oxo-1,3,5-triazinane-1-carboximidamide (PubChem CID 122679646) has the molecular formula C15H22BrN5O and a molecular weight of 368.28 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N,N',3,5-tetramethyl-4-oxo-1,3,5-triazinane-1-carboximidamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N,N',3,5-tetramethyl-4-oxo-1,3,5-triazinane-1-carboximidamide |
|---|---|
| PubChem CID | 122679646 |
| Molecular Formula | C15H22BrN5O |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N,N',3,5-tetramethyl-4-oxo-1,3,5-triazinane-1-carboximidamide |
| SMILES | C/N=C(\N(C)Cc1ccc(Br)cc1)N1CN(C)C(=O)N(C)C1 |
| InChI | InChI=1S/C15H22BrN5O/c1-17-14(21-10-19(3)15(22)20(4)11-21)18(2)9-12-5-7-13(16)8-6-12/h5-8H,9-11H2,1-4H3/b17-14+ |
| InChIKey | MUKHOOBUDWNZTF-SAPNQHFASA-N |
| XLogP | 2.08 |
| TPSA | 42.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|